Wiley SpectraBase; SpectraBase Compound ID=1YEkRjFctN
http://spectrabase.com/compound/1YEkRjFctN (accessed Oct 26, 2020).

2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazepin-5-one
SpectraBase Compound ID 1YEkRjFctN
InChI InChI=1S/C15H12ClNO2/c16-11-7-5-10(6-8-11)14-9-17-15(18)12-3-1-2-4-13(12)19-14/h1-8,14H,9H2,(H,17,18)
InChIKey HVEMHRVGRRNAFB-UHFFFAOYSA-N
Mol Weight 273.72 g/mol
Molecular Formula C15H12ClNO2
Exact Mass 273.055656 g/mol