Wiley SpectraBase; SpectraBase Compound ID=1VEZ2lwk2L
http://spectrabase.com/compound/1VEZ2lwk2L (accessed Oct 26, 2020).

DIMETHYL-(1-(2,6-DIMETHYLPHENYL)-3-METHYLTHIO-1H-1,2,4-TRIAZOL-5-YL)-IMINODITHIOCARBONATE
SpectraBase Compound ID 1VEZ2lwk2L
InChI InChI=1S/C14H18N4S3/c1-9-7-6-8-10(2)11(9)18-12(15-13(17-18)19-3)16-14(20-4)21-5/h6-8H,1-5H3
InChIKey VIUWQSOHGGATGF-UHFFFAOYSA-N
Mol Weight 338.51 g/mol
Molecular Formula C14H18N4S3
Exact Mass 338.069362 g/mol