Wiley SpectraBase; SpectraBase Compound ID=1TCDusAtLtT
http://spectrabase.com/compound/1TCDusAtLtT (accessed Oct 26, 2020).

METHYL-D-GLUCARATE-1,4-LACTONE
SpectraBase Compound ID 1TCDusAtLtT
InChI InChI=1S/C7H10O7/c1-13-6(11)4(10)5-2(8)3(9)7(12)14-5/h2-5,8-10H,1H3/t2-,3-,4+,5+/m1/s1
InChIKey KIDJCDRSJYKKRK-MBMOQRBOSA-N
Mol Weight 206.15 g/mol
Molecular Formula C7H10O7
Exact Mass 206.042653 g/mol
Enantiomer InChIKey KIDJCDRSJYKKRK-QMKXCQHVSA-N