Wiley SpectraBase; SpectraBase Compound ID=1PwQJPzho4
http://spectrabase.com/compound/1PwQJPzho4 (accessed Oct 28, 2020).

ETHYL-BICYClO-[4.4.0]-DECAL-4-ONE-1-OATE;CIS-ISOMER
SpectraBase Compound ID 1PwQJPzho4
InChI InChI=1S/C13H20O3/c1-2-16-12(15)13-7-4-3-5-10(13)9-11(14)6-8-13/h10H,2-9H2,1H3/t10-,13-/m1/s1
InChIKey ZIHARWRTSSAORZ-ZWNOBZJWSA-N
Mol Weight 224.3 g/mol
Molecular Formula C13H20O3
Exact Mass 224.141245 g/mol
Enantiomer InChIKey ZIHARWRTSSAORZ-GWCFXTLKSA-N