Wiley SpectraBase; SpectraBase Compound ID=1IoViyJ1bH
http://spectrabase.com/compound/1IoViyJ1bH (accessed Oct 26, 2020).

BICYClO-[4.4.0]-DECAL-4-ONE;TRANS-ISOMER
SpectraBase Compound ID 1IoViyJ1bH
InChI InChI=1S/C10H16O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h8-9H,1-7H2/t8-,9-/m0/s1
InChIKey LGVJRKCQQHOWAU-IUCAKERBSA-N
Mol Weight 152.24 g/mol
Molecular Formula C10H16O
Exact Mass 152.120115 g/mol
Enantiomer InChIKey LGVJRKCQQHOWAU-RKDXNWHRSA-N