Wiley SpectraBase; SpectraBase Compound ID=1C2V66PQbg
http://spectrabase.com/compound/1C2V66PQbg (accessed Sep 29, 2020).

N,N-DIETHYL-2,3-DIHYDRO-2-METHYL-3-PHENYL-2-AZET-CARBOXAMIDE-1-OXIDE
SpectraBase Compound ID 1C2V66PQbg
InChI InChI=1S/C15H20N2O2/c1-4-16(5-2)14(18)15(3)13(11-17(15)19)12-9-7-6-8-10-12/h6-11,13H,4-5H2,1-3H3
InChIKey SFDSQOLMDGECDE-UHFFFAOYSA-N
Mol Weight 260.34 g/mol
Molecular Formula C15H20N2O2
Exact Mass 260.152478 g/mol