Wiley SpectraBase; SpectraBase Compound ID=1B7W1Qf8BK
http://spectrabase.com/compound/1B7W1Qf8BK (accessed Sep 23, 2020).

(3R*,11R*)-11-METHYL-1-OXADISPIRO-[2.0.6.3]-TRIDECAN-13-ONE
SpectraBase Compound ID 1B7W1Qf8BK
InChI InChI=1S/C13H20O2/c1-10-8-11(14)13(9-15-13)12(10)6-4-2-3-5-7-12/h10H,2-9H2,1H3/t10-,13-/m0/s1
InChIKey VNYZSFJAKIQOFU-GWCFXTLKSA-N
Mol Weight 208.3 g/mol
Molecular Formula C13H20O2
Exact Mass 208.14633 g/mol
Enantiomer InChIKey VNYZSFJAKIQOFU-ZWNOBZJWSA-N