Wiley SpectraBase; SpectraBase Compound ID=1AiaQYbSvy
http://spectrabase.com/compound/1AiaQYbSvy (accessed Sep 26, 2020).

3-HYDROXYCARBOFURAN
SpectraBase Compound ID 1AiaQYbSvy
InChI InChI=1S/C12H15NO4/c1-12(2)10(14)7-5-4-6-8(9(7)17-12)16-11(15)13-3/h4-6,10,14H,1-3H3,(H,13,15)
InChIKey RHSUJRQZTQNSLL-UHFFFAOYSA-N
Mol Weight 237.25 g/mol
Molecular Formula C12H15NO4
Exact Mass 237.100108 g/mol