Wiley SpectraBase; SpectraBase Compound ID=1AWs9QvjZp
http://spectrabase.com/compound/1AWs9QvjZp (accessed Sep 27, 2020).

picolinaldehyde, 4-[m-(methylthio)phenyl]-3-thiosemicarbazone
SpectraBase Compound ID 1AWs9QvjZp
InChI InChI=1S/C14H14N4S2/c1-20-13-7-4-6-11(9-13)17-14(19)18-16-10-12-5-2-3-8-15-12/h2-10H,1H3,(H2,17,18,19)/b16-10+
InChIKey FDCDJXRWNVTDTR-MHWRWJLKSA-N
Mol Weight 302.41 g/mol
Molecular Formula C14H14N4S2
Exact Mass 302.06599 g/mol