Wiley SpectraBase; SpectraBase Compound ID=1ACBZNoLDx
http://spectrabase.com/compound/1ACBZNoLDx (accessed Oct 01, 2020).

1-METHYL-3A-PHENYL-OCTAHYDROPHOSPHINDOLE-1-OXIDE
SpectraBase Compound ID 1ACBZNoLDx
InChI InChI=1S/C15H21OP/c1-17(16)12-11-15(10-6-5-9-14(15)17)13-7-3-2-4-8-13/h2-4,7-8,14H,5-6,9-12H2,1H3
InChIKey ZWKNFRJZWWVGGM-UHFFFAOYSA-N
Mol Weight 248.31 g/mol
Molecular Formula C15H21OP
Exact Mass 248.133004 g/mol