Wiley SpectraBase; SpectraBase Compound ID=19OkeAfRzp
http://spectrabase.com/compound/19OkeAfRzp (accessed Oct 01, 2020).

5,6-CYCLOBUTYLEN-2-PHENYL-5,6-DIHYDRO-4H-1,3-OXAZINE
SpectraBase Compound ID 19OkeAfRzp
InChI InChI=1S/C14H17NO/c1-2-6-11(7-3-1)14-15-10-12-8-4-5-9-13(12)16-14/h1-3,6-7,12-13H,4-5,8-10H2/t12-,13-/m1/s1
InChIKey LLQDDIVSWQGFTO-CHWSQXEVSA-N
Mol Weight 215.3 g/mol
Molecular Formula C14H17NO
Exact Mass 215.131014 g/mol
Enantiomer InChIKey LLQDDIVSWQGFTO-STQMWFEESA-N