Wiley SpectraBase; SpectraBase Compound ID=19NqkuafQQ
http://spectrabase.com/compound/19NqkuafQQ (accessed Sep 29, 2020).

4-METHYL-6-MORPHOLINO-3-NITROSO-SALICYLIC-ACID-METHYLESTER
SpectraBase Compound ID 19NqkuafQQ
InChI InChI=1S/C13H16N2O5/c1-8-7-9(15-3-5-20-6-4-15)10(13(17)19-2)12(16)11(8)14-18/h7,16H,3-6H2,1-2H3
InChIKey QHIYPHHTEAUFGP-UHFFFAOYSA-N
Mol Weight 280.28 g/mol
Molecular Formula C13H16N2O5
Exact Mass 280.105922 g/mol