Wiley SpectraBase; SpectraBase Compound ID=16ogFO61Bl
http://spectrabase.com/compound/16ogFO61Bl (accessed Sep 23, 2020).

SpectraBase Compound ID 16ogFO61Bl
InChI InChI=1S/C14H14N2OS/c1-8-4-5-13-10(6-8)15-11-7-12(9(2)17)16(3)14(11)18-13/h4-7,15H,1-3H3
Mol Weight 258.34 g/mol
Molecular Formula C14H14N2OS
Exact Mass 258.082685 g/mol