Wiley SpectraBase; SpectraBase Compound ID=15hzlPQCQH
http://spectrabase.com/compound/15hzlPQCQH (accessed Sep 28, 2020).

SpectraBase Compound ID 15hzlPQCQH
InChI InChI=1S/C9H15IO3/c1-3-8-7(10)4-6(13-8)5-9(11)12-2/h6-8H,3-5H2,1-2H3/t6-,7-,8+/m1/s1
Mol Weight 298.12 g/mol
Molecular Formula C9H15IO3
Exact Mass 298.006596 g/mol