Wiley SpectraBase; SpectraBase Compound ID=15NoGXR5ci
http://spectrabase.com/compound/15NoGXR5ci (accessed Sep 30, 2020).

SpectraBase Compound ID 15NoGXR5ci
InChI InChI=1S/C11H11BrO4/c12-9-3-1-8(2-4-9)7-16-11(15)6-5-10(13)14/h1-4H,5-7H2,(H,13,14)
Mol Weight 287.11 g/mol
Molecular Formula C11H11BrO4
Exact Mass 285.98407 g/mol