Wiley SpectraBase; SpectraBase Compound ID=12yJgyMW3H
http://spectrabase.com/compound/12yJgyMW3H (accessed Sep 29, 2020).

SpectraBase Compound ID 12yJgyMW3H
InChI InChI=1S/C13H11NO/c15-13-8-5-11(6-9-13)4-7-12-3-1-2-10-14-12/h1-10,15H/b7-4+
Mol Weight 197.24 g/mol
Molecular Formula C13H11NO
Exact Mass 197.084064 g/mol