Wiley SpectraBase; SpectraBase Compound ID=12ZfrerG2G
http://spectrabase.com/compound/12ZfrerG2G (accessed Sep 23, 2020).

SpectraBase Compound ID 12ZfrerG2G
InChI InChI=1S/C10H10N2O/c1-12(8-7-10(13)11-12)9-5-3-2-4-6-9/h2-8H,1H3
Mol Weight 174.2 g/mol
Molecular Formula C10H10N2O
Exact Mass 174.079313 g/mol